C18H15ClN2OS2 — CID 135448778
(5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 135448778) has the molecular formula C18H15ClN2OS2 and a molecular weight of 374.92 g/mol. Its IUPAC name is (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135448778 |
| Molecular Formula | C18H15ClN2OS2 |
| Molecular Weight | 374.92 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | (5Z)-2-(3-chloro-2-methylphenyl)imino-5-[(4-methylsulfanylphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | CSc1ccc(/C=C2\S/C(=N/c3cccc(Cl)c3C)NC2=O)cc1 |
| InChI | InChI=1S/C18H15ClN2OS2/c1-11-14(19)4-3-5-15(11)20-18-21-17(22)16(24-18)10-12-6-8-13(23-2)9-7-12/h3-10H,1-2H3,(H,20,21,22)/b16-10- |
| InChIKey | JQSZZUTWNAPWGC-YBEGLDIGSA-N |
| XLogP | 5.26 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|