3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid

C8H8N4O3 — CID 135449008

IUPAC3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid
SMILESO=C(O)CCc1cnn2c(=O)[nH]cnc12
InChIInChI=1S/C8H8N4O3/c13-6(14)2-1-5-3-11-12-7(5)9-4-10-8(12)15/h3-4H,1-2H2,(H,13,14)(H,9,10,15)
InChIKeySTQRKUGDBCGLQQ-UHFFFAOYSA-N
MW208.18 g/mol
LogP-0.57
Rot. Bonds3

About 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid

3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid (PubChem CID 135449008) has the molecular formula C8H8N4O3 and a molecular weight of 208.18 g/mol. Its IUPAC name is 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid.

Molecular Properties

Compound Name3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid
PubChem CID135449008
Molecular FormulaC8H8N4O3
Molecular Weight208.18 g/mol
Exact Mass208.06
IUPAC Name3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid
SMILESO=C(O)CCc1cnn2c(=O)[nH]cnc12
InChIInChI=1S/C8H8N4O3/c13-6(14)2-1-5-3-11-12-7(5)9-4-10-8(12)15/h3-4H,1-2H2,(H,13,14)(H,9,10,15)
InChIKeySTQRKUGDBCGLQQ-UHFFFAOYSA-N
XLogP-0.57
TPSA100.35 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.18
LogP ≤ 5-0.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid?
The IUPAC name of 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid (CID 135449008) is 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid.
What is the SMILES notation for 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid?
The canonical SMILES for 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid is O=C(O)CCc1cnn2c(=O)[nH]cnc12.
What is the InChIKey of 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid?
The InChIKey is STQRKUGDBCGLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O3/c13-6(14)2-1-5-3-11-12-7(5)9-4-10-8(12)15/h3-4H,1-2H2,(H,13,14)(H,9,10,15).
What are the key properties of 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid?
3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid has a molecular weight of 208.18 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-oxo-3H-pyrazolo[1,5-a][1,3,5]triazin-8-yl)propanoic acid is sourced from PubChem (CID 135449008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).