C10H15N3O — CID 135449177
(NZ)-N-(3,6,6-trimethyl-5,7-dihydro-2H-indazol-4-ylidene)hydroxylamine (PubChem CID 135449177) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (NZ)-N-(3,6,6-trimethyl-5,7-dihydro-2H-indazol-4-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(3,6,6-trimethyl-5,7-dihydro-2H-indazol-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 135449177 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (NZ)-N-(3,6,6-trimethyl-5,7-dihydro-2H-indazol-4-ylidene)hydroxylamine |
| SMILES | Cc1[nH]nc2c1/C(=N\O)CC(C)(C)C2 |
| InChI | InChI=1S/C10H15N3O/c1-6-9-7(12-11-6)4-10(2,3)5-8(9)13-14/h14H,4-5H2,1-3H3,(H,11,12)/b13-8- |
| InChIKey | XGMNWFVIYXUOGP-JYRVWZFOSA-N |
| XLogP | 1.87 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|