C15H13N3OS — CID 135449209
(2Z)-5-benzyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one (PubChem CID 135449209) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is (2Z)-5-benzyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-5-benzyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135449209 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2Z)-5-benzyl-2-pyridin-2-ylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1N/C(=N/c2ccccn2)SC1Cc1ccccc1 |
| InChI | InChI=1S/C15H13N3OS/c19-14-12(10-11-6-2-1-3-7-11)20-15(18-14)17-13-8-4-5-9-16-13/h1-9,12H,10H2,(H,16,17,18,19) |
| InChIKey | UYUQMWJRRJSXEU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|