C14H12N2O2 — CID 135449220
2-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5-dimethylfuran-3-carbonitrile (PubChem CID 135449220) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5-dimethylfuran-3-carbonitrile.
| Compound Name | 2-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5-dimethylfuran-3-carbonitrile |
|---|---|
| PubChem CID | 135449220 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-[(E)-(2-hydroxyphenyl)methylideneamino]-4,5-dimethylfuran-3-carbonitrile |
| SMILES | Cc1oc(/N=C/c2ccccc2O)c(C#N)c1C |
| InChI | InChI=1S/C14H12N2O2/c1-9-10(2)18-14(12(9)7-15)16-8-11-5-3-4-6-13(11)17/h3-6,8,17H,1-2H3/b16-8+ |
| InChIKey | KWCGSFZYZYJEML-LZYBPNLTSA-N |
| XLogP | 3.22 |
| TPSA | 69.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|