About 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol
2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (PubChem CID 135449248) has the molecular formula C11H12N4O2
and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
Molecular Properties
| Compound Name | 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| PubChem CID | 135449248 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol |
| SMILES | CCOc1cc(/C=N/n2cnnc2)ccc1O |
| InChI | InChI=1S/C11H12N4O2/c1-2-17-11-5-9(3-4-10(11)16)6-14-15-7-12-13-8-15/h3-8,16H,2H2,1H3/b14-6+ |
| InChIKey | HSFWYOMSBYLXGW-MKMNVTDBSA-N |
| XLogP | 1.26 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The IUPAC name of 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol (CID 135449248) is 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol.
What is the SMILES notation for 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The canonical SMILES for 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is CCOc1cc(/C=N/n2cnnc2)ccc1O.
What is the InChIKey of 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
The InChIKey is HSFWYOMSBYLXGW-MKMNVTDBSA-N. The full InChI is InChI=1S/C11H12N4O2/c1-2-17-11-5-9(3-4-10(11)16)6-14-15-7-12-13-8-15/h3-8,16H,2H2,1H3/b14-6+.
What are the key properties of 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol?
2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol has a molecular weight of 232.24 g/mol, XLogP of 1.26, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-[(E)-1,2,4-triazol-4-yliminomethyl]phenol is sourced from PubChem (CID 135449248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).