About (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide
(2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide (PubChem CID 135449505) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide.
Molecular Properties
| Compound Name | (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide |
| PubChem CID | 135449505 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide |
| SMILES | CC1(C)Cc2ccccc2C(/C(=N/O)C(N)=O)=N1 |
| InChI | InChI=1S/C13H15N3O2/c1-13(2)7-8-5-3-4-6-9(8)10(15-13)11(16-18)12(14)17/h3-6,18H,7H2,1-2H3,(H2,14,17)/b16-11- |
| InChIKey | AEYZGCDFSMSMSP-WJDWOHSUSA-N |
| XLogP | 1.13 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide?
The IUPAC name of (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide (CID 135449505) is (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide.
What is the SMILES notation for (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide?
The canonical SMILES for (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide is CC1(C)Cc2ccccc2C(/C(=N/O)C(N)=O)=N1.
What is the InChIKey of (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide?
The InChIKey is AEYZGCDFSMSMSP-WJDWOHSUSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-13(2)7-8-5-3-4-6-9(8)10(15-13)11(16-18)12(14)17/h3-6,18H,7H2,1-2H3,(H2,14,17)/b16-11-.
What are the key properties of (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide?
(2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide has a molecular weight of 245.28 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(3,3-dimethyl-4H-isoquinolin-1-yl)-2-hydroxyiminoacetamide is sourced from PubChem (CID 135449505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).