C11H12N6S — CID 135449604
7-methylsulfanyl-3,4,5,6,8,10-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 135449604) has the molecular formula C11H12N6S and a molecular weight of 260.33 g/mol. Its IUPAC name is 7-methylsulfanyl-3,4,5,6,8,10-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 7-methylsulfanyl-3,4,5,6,8,10-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 135449604 |
| Molecular Formula | C11H12N6S |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 7-methylsulfanyl-3,4,5,6,8,10-hexazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CSc1nc2[nH]c3c(c2c2nnnn12)CCCC3 |
| InChI | InChI=1S/C11H12N6S/c1-18-11-13-9-8(10-14-15-16-17(10)11)6-4-2-3-5-7(6)12-9/h12H,2-5H2,1H3 |
| InChIKey | GXTLJSGDMQXDSZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |