C19H18N4OS — CID 135449829
4-(3H-1,3-benzothiazol-2-ylidene)-1-[4-(dimethylamino)phenyl]-5-iminopyrrolidin-2-one (PubChem CID 135449829) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 4-(3H-1,3-benzothiazol-2-ylidene)-1-[4-(dimethylamino)phenyl]-5-iminopyrrolidin-2-one.
| Compound Name | 4-(3H-1,3-benzothiazol-2-ylidene)-1-[4-(dimethylamino)phenyl]-5-iminopyrrolidin-2-one |
|---|---|
| PubChem CID | 135449829 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 4-(3H-1,3-benzothiazol-2-ylidene)-1-[4-(dimethylamino)phenyl]-5-iminopyrrolidin-2-one |
| SMILES | [H]/N=C1/C(=C2Nc3ccccc3S2)CC(=O)N1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H18N4OS/c1-22(2)12-7-9-13(10-8-12)23-17(24)11-14(18(23)20)19-21-15-5-3-4-6-16(15)25-19/h3-10,20-21H,11H2,1-2H3/b19-14?,20-18- |
| InChIKey | GVDLCKYVGDJYCB-YVFXQWGISA-N |
| XLogP | 3.90 |
| TPSA | 59.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|