C24H18Cl2N4O6 — CID 135450152
2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(2,4-dichloro-6-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid (PubChem CID 135450152) has the molecular formula C24H18Cl2N4O6 and a molecular weight of 529.34 g/mol. Its IUPAC name is 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(2,4-dichloro-6-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid.
| Compound Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(2,4-dichloro-6-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid |
|---|---|
| PubChem CID | 135450152 |
| Molecular Formula | C24H18Cl2N4O6 |
| Molecular Weight | 529.34 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(2,4-dichloro-6-hydroxyphenyl)-4-hydroxyphenyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cc(C(CC(=O)O)C(=O)O)cc(-c4c(O)cc(Cl)cc4Cl)c3O)[nH]c2c1 |
| InChI | InChI=1S/C24H18Cl2N4O6/c25-11-6-15(26)20(18(31)7-11)13-3-10(12(24(35)36)8-19(32)33)4-14(21(13)34)23-29-16-2-1-9(22(27)28)5-17(16)30-23/h1-7,12,31,34H,8H2,(H3,27,28)(H,29,30)(H,32,33)(H,35,36) |
| InChIKey | JBIXKWJURQJWBD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|