C34H16F10N4O — CID 135450262
3,3-dimethyl-10,15-bis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin-2-ol (PubChem CID 135450262) has the molecular formula C34H16F10N4O and a molecular weight of 686.51 g/mol. Its IUPAC name is 3,3-dimethyl-10,15-bis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin-2-ol.
| Compound Name | 3,3-dimethyl-10,15-bis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin-2-ol |
|---|---|
| PubChem CID | 135450262 |
| Molecular Formula | C34H16F10N4O |
| Molecular Weight | 686.51 g/mol |
| Exact Mass | 686.12 |
| IUPAC Name | 3,3-dimethyl-10,15-bis(2,3,4,5,6-pentafluorophenyl)-21H-porphyrin-2-ol |
| SMILES | CC1(C)C(O)=C2/C=C3/C=CC(=N3)/C(c3c(F)c(F)c(F)c(F)c3F)=C3/C=CC(=N3)/C(c3c(F)c(F)c(F)c(F)c3F)=C3/C=CC(=N3)/C=C/1N2 |
| InChI | InChI=1S/C34H16F10N4O/c1-34(2)18-10-12-4-6-14(46-12)20(22-25(37)29(41)32(44)30(42)26(22)38)16-8-7-15(47-16)19(21-23(35)27(39)31(43)28(40)24(21)36)13-5-3-11(45-13)9-17(48-18)33(34)49/h3-10,48-49H,1-2H3/b11-9-,18-10-,19-15+,20-14+ |
| InChIKey | FVZBKTLDTJXAMB-JHKQSGJFSA-N |
| XLogP | 8.41 |
| TPSA | 69.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.51 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|