About 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide
2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide (PubChem CID 135450383) has the molecular formula C24H21N3O5
and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide |
| PubChem CID | 135450383 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide |
| SMILES | COc1ccc(/N=c2\oc3cc(O)ccc3cc2C(=O)Nc2cccc(C)n2)cc1OC |
| InChI | InChI=1S/C24H21N3O5/c1-14-5-4-6-22(25-14)27-23(29)18-11-15-7-9-17(28)13-20(15)32-24(18)26-16-8-10-19(30-2)21(12-16)31-3/h4-13,28H,1-3H3,(H,25,27,29)/b26-24- |
| InChIKey | FLCMSIBUTPDBOT-LCUIJRPUSA-N |
| XLogP | 4.34 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide?
The IUPAC name of 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide (CID 135450383) is 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide is COc1ccc(/N=c2\oc3cc(O)ccc3cc2C(=O)Nc2cccc(C)n2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide?
The InChIKey is FLCMSIBUTPDBOT-LCUIJRPUSA-N. The full InChI is InChI=1S/C24H21N3O5/c1-14-5-4-6-22(25-14)27-23(29)18-11-15-7-9-17(28)13-20(15)32-24(18)26-16-8-10-19(30-2)21(12-16)31-3/h4-13,28H,1-3H3,(H,25,27,29)/b26-24-.
What are the key properties of 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide?
2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide has a molecular weight of 431.45 g/mol, XLogP of 4.34, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)imino-7-hydroxy-N-(6-methyl-2-pyridinyl)chromene-3-carboxamide is sourced from PubChem (CID 135450383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).