C18H19N3O6S2 — CID 135450567
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-(dimethylsulfamoyl)benzoate (PubChem CID 135450567) has the molecular formula C18H19N3O6S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-(dimethylsulfamoyl)benzoate.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 135450567 |
| Molecular Formula | C18H19N3O6S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.07 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]ethyl 4-(dimethylsulfamoyl)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)OCC/N=C2\NS(=O)(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C18H19N3O6S2/c1-21(2)29(25,26)14-9-7-13(8-10-14)18(22)27-12-11-19-17-15-5-3-4-6-16(15)28(23,24)20-17/h3-10H,11-12H2,1-2H3,(H,19,20) |
| InChIKey | LBUJJIAJRRYJEI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|