C20H23NO6S — CID 135450582
4-hydroxy-6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one (PubChem CID 135450582) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one.
| Compound Name | 4-hydroxy-6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one |
|---|---|
| PubChem CID | 135450582 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-hydroxy-6-methyl-3-[7-(2,3,4-trimethoxyphenyl)-2,3,6,7-tetrahydro-1,4-thiazepin-5-yl]pyran-2-one |
| SMILES | COc1ccc(C2CC(c3c(O)cc(C)oc3=O)=NCCS2)c(OC)c1OC |
| InChI | InChI=1S/C20H23NO6S/c1-11-9-14(22)17(20(23)27-11)13-10-16(28-8-7-21-13)12-5-6-15(24-2)19(26-4)18(12)25-3/h5-6,9,16,22H,7-8,10H2,1-4H3 |
| InChIKey | SPVDGHGZUITBBQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |