C23H17FN4O2S — CID 135450606
2-[[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135450606) has the molecular formula C23H17FN4O2S and a molecular weight of 432.48 g/mol. Its IUPAC name is 2-[[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 2-[[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135450606 |
| Molecular Formula | C23H17FN4O2S |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)imidazol-2-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(CSc2ncc(-c3ccc(F)cc3)n2Cc2ccco2)nc2ccccc12 |
| InChI | InChI=1S/C23H17FN4O2S/c24-16-9-7-15(8-10-16)20-12-25-23(28(20)13-17-4-3-11-30-17)31-14-21-26-19-6-2-1-5-18(19)22(29)27-21/h1-12H,13-14H2,(H,26,27,29) |
| InChIKey | OXWMPKCQMXYBPV-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|