About 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one
3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135450638) has the molecular formula C22H24N4O2
and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one.
Molecular Properties
| Compound Name | 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| PubChem CID | 135450638 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CC(C)(C)c1nn(-c2ccccc2)c2[nH]c(=O)c(CNCc3ccco3)cc12 |
| InChI | InChI=1S/C22H24N4O2/c1-22(2,3)19-18-12-15(13-23-14-17-10-7-11-28-17)21(27)24-20(18)26(25-19)16-8-5-4-6-9-16/h4-12,23H,13-14H2,1-3H3,(H,24,27) |
| InChIKey | VUPOJJVUDIXCJU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The IUPAC name of 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one (CID 135450638) is 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one.
What is the SMILES notation for 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The canonical SMILES for 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one is CC(C)(C)c1nn(-c2ccccc2)c2[nH]c(=O)c(CNCc3ccco3)cc12.
What is the InChIKey of 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
The InChIKey is VUPOJJVUDIXCJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N4O2/c1-22(2,3)19-18-12-15(13-23-14-17-10-7-11-28-17)21(27)24-20(18)26(25-19)16-8-5-4-6-9-16/h4-12,23H,13-14H2,1-3H3,(H,24,27).
What are the key properties of 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one?
3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one has a molecular weight of 376.46 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-[(furan-2-ylmethylamino)methyl]-1-phenyl-7H-pyrazolo[5,4-b]pyridin-6-one is sourced from PubChem (CID 135450638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).