C15H13N5O — CID 135450736
4,6-dianilino-1H-1,3,5-triazin-2-one (PubChem CID 135450736) has the molecular formula C15H13N5O and a molecular weight of 279.30 g/mol. Its IUPAC name is 4,6-dianilino-1H-1,3,5-triazin-2-one.
| Compound Name | 4,6-dianilino-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135450736 |
| Molecular Formula | C15H13N5O |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 4,6-dianilino-1H-1,3,5-triazin-2-one |
| SMILES | O=c1nc(Nc2ccccc2)nc(Nc2ccccc2)[nH]1 |
| InChI | InChI=1S/C15H13N5O/c21-15-19-13(16-11-7-3-1-4-8-11)18-14(20-15)17-12-9-5-2-6-10-12/h1-10H,(H3,16,17,18,19,20,21) |
| InChIKey | RQCPXGXHVGRCQZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |