C16H17N5O — CID 135450775
4-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]-2,6-dimethylphenol (PubChem CID 135450775) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 4-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]-2,6-dimethylphenol.
| Compound Name | 4-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 135450775 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 4-[(4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-yl)diazenyl]-2,6-dimethylphenol |
| SMILES | Cc1cc(C)c2c(/N=N/c3cc(C)c(O)c(C)c3)[nH]nc2n1 |
| InChI | InChI=1S/C16H17N5O/c1-8-5-11(4)17-15-13(8)16(21-19-15)20-18-12-6-9(2)14(22)10(3)7-12/h5-7,22H,1-4H3,(H,17,19,21)/b20-18+ |
| InChIKey | SFVDVUBICNIODF-CZIZESTLSA-N |
| XLogP | 4.31 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|