C15H17N5O5 — CID 135451510
12-amino-3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one (PubChem CID 135451510) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is 12-amino-3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one.
| Compound Name | 12-amino-3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one |
|---|---|
| PubChem CID | 135451510 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 12-amino-3-[(2R,3R,4R,5R)-4-hydroxy-5-(hydroxymethyl)-3-methoxyoxolan-2-yl]-3,5,7,9-tetrazatricyclo[6.4.1.04,13]trideca-1,4(13),5,8,11-pentaen-10-one |
| SMILES | CO[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1n1cc2c(N)cc(=O)nc3c2c1N=CN3 |
| InChI | InChI=1S/C15H17N5O5/c1-24-12-11(23)8(4-21)25-15(12)20-3-6-7(16)2-9(22)19-13-10(6)14(20)18-5-17-13/h2-3,5,8,11-12,15,21,23H,4,16H2,1H3,(H,17,18,19,22)/t8-,11-,12-,15-/m1/s1 |
| InChIKey | RJFIQUNBXWRVTA-PMXXHBEXSA-N |
| XLogP | -0.67 |
| TPSA | 144.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |