C9H15N3O2 — CID 135451986
2-(4-hydroxybutylamino)-4-methyl-1H-pyrimidin-6-one (PubChem CID 135451986) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(4-hydroxybutylamino)-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-(4-hydroxybutylamino)-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135451986 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(4-hydroxybutylamino)-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(NCCCCO)n1 |
| InChI | InChI=1S/C9H15N3O2/c1-7-6-8(14)12-9(11-7)10-4-2-3-5-13/h6,13H,2-5H2,1H3,(H2,10,11,12,14) |
| InChIKey | JRYGVAVEPWMOEM-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|