About 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole
3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole (PubChem CID 135452014) has the molecular formula C13H8N4O
and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole |
| PubChem CID | 135452014 |
| Molecular Formula | C13H8N4O |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole |
| SMILES | c1ccc2c(c1)ncc1[nH]c(-c3ccon3)nc12 |
| InChI | InChI=1S/C13H8N4O/c1-2-4-9-8(3-1)12-11(7-14-9)15-13(16-12)10-5-6-18-17-10/h1-7H,(H,15,16) |
| InChIKey | QCKRJBBLFKOOMQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole?
The IUPAC name of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole (CID 135452014) is 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole.
What is the SMILES notation for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole?
The canonical SMILES for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole is c1ccc2c(c1)ncc1[nH]c(-c3ccon3)nc12.
What is the InChIKey of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole?
The InChIKey is QCKRJBBLFKOOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N4O/c1-2-4-9-8(3-1)12-11(7-14-9)15-13(16-12)10-5-6-18-17-10/h1-7H,(H,15,16).
What are the key properties of 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole?
3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole has a molecular weight of 236.23 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3H-imidazo[4,5-c]quinolin-2-yl)-1,2-oxazole is sourced from PubChem (CID 135452014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).