C16H18ClNO3 — CID 135452131
2-[(5-chloro-2-methoxyphenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one (PubChem CID 135452131) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxyphenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one.
| Compound Name | 2-[(5-chloro-2-methoxyphenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135452131 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-[(5-chloro-2-methoxyphenyl)iminomethyl]-3-hydroxy-5,5-dimethylcyclohex-2-en-1-one |
| SMILES | COc1ccc(Cl)cc1/N=C/C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C16H18ClNO3/c1-16(2)7-13(19)11(14(20)8-16)9-18-12-6-10(17)4-5-15(12)21-3/h4-6,9,19H,7-8H2,1-3H3/b18-9+ |
| InChIKey | JKOSTLYWALGVNY-GIJQJNRQSA-N |
| XLogP | 4.25 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|