About 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide
2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135452430) has the molecular formula C10H7Cl2N3O2
and a molecular weight of 272.09 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide |
| PubChem CID | 135452430 |
| Molecular Formula | C10H7Cl2N3O2 |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | N#CCC(=O)N/N=C/c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H7Cl2N3O2/c11-7-3-6(10(17)8(12)4-7)5-14-15-9(16)1-2-13/h3-5,17H,1H2,(H,15,16)/b14-5+ |
| InChIKey | GGZWKNIMUFJINN-LHHJGKSTSA-N |
| XLogP | 2.06 |
| TPSA | 85.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide?
The IUPAC name of 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide (CID 135452430) is 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide.
What is the SMILES notation for 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide?
The canonical SMILES for 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide is N#CCC(=O)N/N=C/c1cc(Cl)cc(Cl)c1O.
What is the InChIKey of 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide?
The InChIKey is GGZWKNIMUFJINN-LHHJGKSTSA-N. The full InChI is InChI=1S/C10H7Cl2N3O2/c11-7-3-6(10(17)8(12)4-7)5-14-15-9(16)1-2-13/h3-5,17H,1H2,(H,15,16)/b14-5+.
What are the key properties of 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide?
2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide has a molecular weight of 272.09 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]acetamide is sourced from PubChem (CID 135452430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).