C15H11ClN2O3 — CID 135452683
2-(3-chloro-4-hydroxy-5-methoxyphenyl)-3H-quinazolin-4-one (PubChem CID 135452683) has the molecular formula C15H11ClN2O3 and a molecular weight of 302.72 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxy-5-methoxyphenyl)-3H-quinazolin-4-one.
| Compound Name | 2-(3-chloro-4-hydroxy-5-methoxyphenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135452683 |
| Molecular Formula | C15H11ClN2O3 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 2-(3-chloro-4-hydroxy-5-methoxyphenyl)-3H-quinazolin-4-one |
| SMILES | COc1cc(-c2nc3ccccc3c(=O)[nH]2)cc(Cl)c1O |
| InChI | InChI=1S/C15H11ClN2O3/c1-21-12-7-8(6-10(16)13(12)19)14-17-11-5-3-2-4-9(11)15(20)18-14/h2-7,19H,1H3,(H,17,18,20) |
| InChIKey | ARWZLVSPYHOWHJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |