C18H14ClIN2O3 — CID 135452778
(4Z)-2-(3-chlorophenyl)-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-5-methylpyrazol-3-one (PubChem CID 135452778) has the molecular formula C18H14ClIN2O3 and a molecular weight of 468.68 g/mol. Its IUPAC name is (4Z)-2-(3-chlorophenyl)-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(3-chlorophenyl)-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 135452778 |
| Molecular Formula | C18H14ClIN2O3 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 467.97 |
| IUPAC Name | (4Z)-2-(3-chlorophenyl)-4-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylidene]-5-methylpyrazol-3-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3cccc(Cl)c3)N=C2C)cc(I)c1O |
| InChI | InChI=1S/C18H14ClIN2O3/c1-10-14(6-11-7-15(20)17(23)16(8-11)25-2)18(24)22(21-10)13-5-3-4-12(19)9-13/h3-9,23H,1-2H3/b14-6- |
| InChIKey | ZHINACFRTYJZSA-NSIKDUERSA-N |
| XLogP | 4.46 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|