C25H21FN4O6 — CID 135452882
2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-fluoro-2-hydroxyphenyl)-4-hydroxyphenyl]-2-methylbutanedioic acid (PubChem CID 135452882) has the molecular formula C25H21FN4O6 and a molecular weight of 492.46 g/mol. Its IUPAC name is 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-fluoro-2-hydroxyphenyl)-4-hydroxyphenyl]-2-methylbutanedioic acid.
| Compound Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-fluoro-2-hydroxyphenyl)-4-hydroxyphenyl]-2-methylbutanedioic acid |
|---|---|
| PubChem CID | 135452882 |
| Molecular Formula | C25H21FN4O6 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(5-fluoro-2-hydroxyphenyl)-4-hydroxyphenyl]-2-methylbutanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cc(C(C)(CC(=O)O)C(=O)O)cc(-c4cc(F)ccc4O)c3O)[nH]c2c1 |
| InChI | InChI=1S/C25H21FN4O6/c1-25(24(35)36,10-20(32)33)12-7-15(14-9-13(26)3-5-19(14)31)21(34)16(8-12)23-29-17-4-2-11(22(27)28)6-18(17)30-23/h2-9,31,34H,10H2,1H3,(H3,27,28)(H,29,30)(H,32,33)(H,35,36) |
| InChIKey | MQKCVCRFUKAIAV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 193.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|