C24H20F3N5O4 — CID 135452891
4-[[3-(3-aminophenyl)-4-(trifluoromethoxy)phenyl]diazenyl]-5-(3,4-dimethoxyphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 135452891) has the molecular formula C24H20F3N5O4 and a molecular weight of 499.45 g/mol. Its IUPAC name is 4-[[3-(3-aminophenyl)-4-(trifluoromethoxy)phenyl]diazenyl]-5-(3,4-dimethoxyphenyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-[[3-(3-aminophenyl)-4-(trifluoromethoxy)phenyl]diazenyl]-5-(3,4-dimethoxyphenyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 135452891 |
| Molecular Formula | C24H20F3N5O4 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[[3-(3-aminophenyl)-4-(trifluoromethoxy)phenyl]diazenyl]-5-(3,4-dimethoxyphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | COc1ccc(-c2[nH][nH]c(=O)c2/N=N/c2ccc(OC(F)(F)F)c(-c3cccc(N)c3)c2)cc1OC |
| InChI | InChI=1S/C24H20F3N5O4/c1-34-19-8-6-14(11-20(19)35-2)21-22(23(33)32-30-21)31-29-16-7-9-18(36-24(25,26)27)17(12-16)13-4-3-5-15(28)10-13/h3-12H,28H2,1-2H3,(H2,30,32,33)/b31-29+ |
| InChIKey | JCONDXOIOWYFKU-OWWNRXNESA-N |
| XLogP | 5.95 |
| TPSA | 127.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|