C18H22N4O5S — CID 135453101
2-butyl-5-hydroxy-4-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-propan-2-ylpyridazin-3-one (PubChem CID 135453101) has the molecular formula C18H22N4O5S and a molecular weight of 406.46 g/mol. Its IUPAC name is 2-butyl-5-hydroxy-4-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-propan-2-ylpyridazin-3-one.
| Compound Name | 2-butyl-5-hydroxy-4-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-propan-2-ylpyridazin-3-one |
|---|---|
| PubChem CID | 135453101 |
| Molecular Formula | C18H22N4O5S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-butyl-5-hydroxy-4-(7-hydroxy-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-yl)-6-propan-2-ylpyridazin-3-one |
| SMILES | CCCCn1nc(C(C)C)c(O)c(C2=NS(=O)(=O)c3cc(O)ccc3N2)c1=O |
| InChI | InChI=1S/C18H22N4O5S/c1-4-5-8-22-18(25)14(16(24)15(20-22)10(2)3)17-19-12-7-6-11(23)9-13(12)28(26,27)21-17/h6-7,9-10,23-24H,4-5,8H2,1-3H3,(H,19,21) |
| InChIKey | MGCDWFKQBPSQDD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|