C14H10ClN3O3 — CID 135453202
4-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazol-5-one (PubChem CID 135453202) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 135453202 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-(2-chlorophenyl)-3-(2,4-dihydroxyphenyl)-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(-c2ccc(O)cc2O)n1-c1ccccc1Cl |
| InChI | InChI=1S/C14H10ClN3O3/c15-10-3-1-2-4-11(10)18-13(16-17-14(18)21)9-6-5-8(19)7-12(9)20/h1-7,19-20H,(H,17,21) |
| InChIKey | YICLQFKKTKLDNP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |