C8H4N4O4 — CID 135453303
3-oxido-5,8-dihydro-[1,2,5]oxadiazolo[3,4-g]quinoxalin-3-ium-6,7-dione (PubChem CID 135453303) has the molecular formula C8H4N4O4 and a molecular weight of 220.14 g/mol. Its IUPAC name is 3-oxido-5,8-dihydro-[1,2,5]oxadiazolo[3,4-g]quinoxalin-3-ium-6,7-dione.
| Compound Name | 3-oxido-5,8-dihydro-[1,2,5]oxadiazolo[3,4-g]quinoxalin-3-ium-6,7-dione |
|---|---|
| PubChem CID | 135453303 |
| Molecular Formula | C8H4N4O4 |
| Molecular Weight | 220.14 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 3-oxido-5,8-dihydro-[1,2,5]oxadiazolo[3,4-g]quinoxalin-3-ium-6,7-dione |
| SMILES | O=c1[nH]c2cc3no[n+]([O-])c3cc2[nH]c1=O |
| InChI | InChI=1S/C8H4N4O4/c13-7-8(14)10-4-2-6-5(1-3(4)9-7)11-16-12(6)15/h1-2H,(H,9,13)(H,10,14) |
| InChIKey | GBLOKWQVACPFGV-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.14 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|