C24H18F2N4O5 — CID 135453511
2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(3,5-difluorophenyl)-4-hydroxyphenyl]butanedioic acid (PubChem CID 135453511) has the molecular formula C24H18F2N4O5 and a molecular weight of 480.43 g/mol. Its IUPAC name is 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(3,5-difluorophenyl)-4-hydroxyphenyl]butanedioic acid.
| Compound Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(3,5-difluorophenyl)-4-hydroxyphenyl]butanedioic acid |
|---|---|
| PubChem CID | 135453511 |
| Molecular Formula | C24H18F2N4O5 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | 2-[3-(6-carbamimidoyl-1H-benzimidazol-2-yl)-5-(3,5-difluorophenyl)-4-hydroxyphenyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc2nc(-c3cc(C(CC(=O)O)C(=O)O)cc(-c4cc(F)cc(F)c4)c3O)[nH]c2c1 |
| InChI | InChI=1S/C24H18F2N4O5/c25-13-3-11(4-14(26)8-13)15-5-12(16(24(34)35)9-20(31)32)6-17(21(15)33)23-29-18-2-1-10(22(27)28)7-19(18)30-23/h1-8,16,33H,9H2,(H3,27,28)(H,29,30)(H,31,32)(H,34,35) |
| InChIKey | ZLNHFHLDTQEYRH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 173.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|