C18H29NO2 — CID 1354536
[(1S,3R,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]methyl 2-piperidin-1-ylacetate (PubChem CID 1354536) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is [(1S,3R,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]methyl 2-piperidin-1-ylacetate.
| Compound Name | [(1S,3R,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]methyl 2-piperidin-1-ylacetate |
|---|---|
| PubChem CID | 1354536 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | [(1S,3R,6R)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]methyl 2-piperidin-1-ylacetate |
| SMILES | CC1=C[C@@H]2[C@H](C[C@H]1COC(=O)CN1CCCCC1)C2(C)C |
| InChI | InChI=1S/C18H29NO2/c1-13-9-15-16(18(15,2)3)10-14(13)12-21-17(20)11-19-7-5-4-6-8-19/h9,14-16H,4-8,10-12H2,1-3H3/t14-,15+,16-/m0/s1 |
| InChIKey | FMQARPSTZNNDJH-XHSDSOJGSA-N |
| XLogP | 3.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|