About (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one
(6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one (PubChem CID 135453808) has the molecular formula C6H12N4O
and a molecular weight of 156.19 g/mol. Its IUPAC name is (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one.
Molecular Properties
| Compound Name | (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one |
| PubChem CID | 135453808 |
| Molecular Formula | C6H12N4O |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one |
| SMILES | CC1(C)CC(=O)NN/C1=N/N |
| InChI | InChI=1S/C6H12N4O/c1-6(2)3-4(11)9-10-5(6)8-7/h3,7H2,1-2H3,(H,8,10)(H,9,11) |
| InChIKey | KBQUNUSFIJWTQR-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one?
The IUPAC name of (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one (CID 135453808) is (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one.
What is the SMILES notation for (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one?
The canonical SMILES for (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one is CC1(C)CC(=O)NN/C1=N/N.
What is the InChIKey of (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one?
The InChIKey is KBQUNUSFIJWTQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O/c1-6(2)3-4(11)9-10-5(6)8-7/h3,7H2,1-2H3,(H,8,10)(H,9,11).
What are the key properties of (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one?
(6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one has a molecular weight of 156.19 g/mol, XLogP of -0.69, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-hydrazinylidene-5,5-dimethyldiazinan-3-one is sourced from PubChem (CID 135453808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).