About N,N'-dihexylethane-1,2-diimine oxide
N,N'-dihexylethane-1,2-diimine oxide (PubChem CID 135453887) has the molecular formula C14H28N2O2
and a molecular weight of 256.39 g/mol. Its IUPAC name is N,N'-dihexylethane-1,2-diimine oxide.
Molecular Properties
| Compound Name | N,N'-dihexylethane-1,2-diimine oxide |
| PubChem CID | 135453887 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N,N'-dihexylethane-1,2-diimine oxide |
| SMILES | CCCCCC/[N+]([O-])=C/C=[N+](\[O-])CCCCCC |
| InChI | InChI=1S/C14H28N2O2/c1-3-5-7-9-11-15(17)13-14-16(18)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/b15-13-,16-14- |
| InChIKey | CYTCLCKQYGYQOF-VMNXYWKNSA-N |
| XLogP | 3.31 |
| TPSA | 52.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dihexylethane-1,2-diimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dihexylethane-1,2-diimine oxide?
The IUPAC name of N,N'-dihexylethane-1,2-diimine oxide (CID 135453887) is N,N'-dihexylethane-1,2-diimine oxide.
What is the SMILES notation for N,N'-dihexylethane-1,2-diimine oxide?
The canonical SMILES for N,N'-dihexylethane-1,2-diimine oxide is CCCCCC/[N+]([O-])=C/C=[N+](\[O-])CCCCCC.
What is the InChIKey of N,N'-dihexylethane-1,2-diimine oxide?
The InChIKey is CYTCLCKQYGYQOF-VMNXYWKNSA-N. The full InChI is InChI=1S/C14H28N2O2/c1-3-5-7-9-11-15(17)13-14-16(18)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3/b15-13-,16-14-.
What are the key properties of N,N'-dihexylethane-1,2-diimine oxide?
N,N'-dihexylethane-1,2-diimine oxide has a molecular weight of 256.39 g/mol, XLogP of 3.31, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dihexylethane-1,2-diimine oxide is sourced from PubChem (CID 135453887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).