About 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione
2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione (PubChem CID 135453933) has the molecular formula C12H17N5O3
and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione.
Molecular Properties
| Compound Name | 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione |
| PubChem CID | 135453933 |
| Molecular Formula | C12H17N5O3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione |
| SMILES | C=CCn1c(=O)n(CCCCO)c2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C12H17N5O3/c1-2-5-16-8-9(14-11(13)15-10(8)19)17(12(16)20)6-3-4-7-18/h2,18H,1,3-7H2,(H3,13,14,15,19) |
| InChIKey | PUOIVZZLKDSHSX-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 118.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione?
The IUPAC name of 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione (CID 135453933) is 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione.
What is the SMILES notation for 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione?
The canonical SMILES for 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione is C=CCn1c(=O)n(CCCCO)c2nc(N)[nH]c(=O)c21.
What is the InChIKey of 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione?
The InChIKey is PUOIVZZLKDSHSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O3/c1-2-5-16-8-9(14-11(13)15-10(8)19)17(12(16)20)6-3-4-7-18/h2,18H,1,3-7H2,(H3,13,14,15,19).
What are the key properties of 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione?
2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione has a molecular weight of 279.30 g/mol, XLogP of -0.57, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-(4-hydroxybutyl)-7-prop-2-enyl-1H-purine-6,8-dione is sourced from PubChem (CID 135453933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).