About [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium
[2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium (PubChem CID 135453993) has the molecular formula C13H19N4O2+
and a molecular weight of 263.32 g/mol. Its IUPAC name is [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium.
Molecular Properties
| Compound Name | [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium |
| PubChem CID | 135453993 |
| Molecular Formula | C13H19N4O2+ |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium |
| SMILES | C[N+](C)(C)CC(=O)NN=C1c2ccccc2NC1O |
| InChI | InChI=1S/C13H18N4O2/c1-17(2,3)8-11(18)15-16-12-9-6-4-5-7-10(9)14-13(12)19/h4-7,13,19H,8H2,1-3H3,(H-,14,15,16,18)/p+1 |
| InChIKey | NIABHNHQHVUTPV-UHFFFAOYSA-O |
| XLogP | -0.04 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium?
The IUPAC name of [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium (CID 135453993) is [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium.
What is the SMILES notation for [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium?
The canonical SMILES for [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium is C[N+](C)(C)CC(=O)NN=C1c2ccccc2NC1O.
What is the InChIKey of [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium?
The InChIKey is NIABHNHQHVUTPV-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H18N4O2/c1-17(2,3)8-11(18)15-16-12-9-6-4-5-7-10(9)14-13(12)19/h4-7,13,19H,8H2,1-3H3,(H-,14,15,16,18)/p+1.
What are the key properties of [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium?
[2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium has a molecular weight of 263.32 g/mol, XLogP of -0.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(2-hydroxy-1,2-dihydroindol-3-ylidene)hydrazinyl]-2-oxoethyl]-trimethylazanium is sourced from PubChem (CID 135453993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).