C22H16Cl2N4O4 — CID 135454268
6-[(3,5-dichlorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 135454268) has the molecular formula C22H16Cl2N4O4 and a molecular weight of 471.30 g/mol. Its IUPAC name is 6-[(3,5-dichlorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-[(3,5-dichlorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 135454268 |
| Molecular Formula | C22H16Cl2N4O4 |
| Molecular Weight | 471.30 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 6-[(3,5-dichlorophenyl)iminomethyl]-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(O)c(/C=N/c3cc(Cl)cc(Cl)c3)c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C22H16Cl2N4O4/c1-26-19-17(21(31)27(2)22(26)32)18(29)16(11-25-14-9-12(23)8-13(24)10-14)20(30)28(19)15-6-4-3-5-7-15/h3-11,29H,1-2H3/b25-11+ |
| InChIKey | MIIAXGZUIGZBGM-OPEKNORGSA-N |
| XLogP | 3.15 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|