C23H20N4O4 — CID 135454270
6-(benzyliminomethyl)-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 135454270) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 6-(benzyliminomethyl)-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 6-(benzyliminomethyl)-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 135454270 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 6-(benzyliminomethyl)-5-hydroxy-1,3-dimethyl-8-phenylpyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(O)c(/C=N/Cc3ccccc3)c(=O)n(-c3ccccc3)c2n(C)c1=O |
| InChI | InChI=1S/C23H20N4O4/c1-25-20-18(22(30)26(2)23(25)31)19(28)17(14-24-13-15-9-5-3-6-10-15)21(29)27(20)16-11-7-4-8-12-16/h3-12,14,28H,13H2,1-2H3/b24-14+ |
| InChIKey | RQIOVHUJKFVDMO-ZVHZXABRSA-N |
| XLogP | 1.71 |
| TPSA | 98.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|