C14H12ClN7O — CID 135454363
3-[(2E)-2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one (PubChem CID 135454363) has the molecular formula C14H12ClN7O and a molecular weight of 329.75 g/mol. Its IUPAC name is 3-[(2E)-2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135454363 |
| Molecular Formula | C14H12ClN7O |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-[(2E)-2-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylidene]hydrazinyl]-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N/Nc1nncc(=O)[nH]1 |
| InChI | InChI=1S/C14H12ClN7O/c1-9-11(7-16-19-14-18-12(23)8-17-20-14)13(15)22(21-9)10-5-3-2-4-6-10/h2-8H,1H3,(H2,18,19,20,23)/b16-7+ |
| InChIKey | JHZCIYTUODDYEG-FRKPEAEDSA-N |
| XLogP | 1.76 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|