About 2-amino-8-methyl-3,7-dihydropteridin-4-one
2-amino-8-methyl-3,7-dihydropteridin-4-one (PubChem CID 135454624) has the molecular formula C7H9N5O
and a molecular weight of 179.18 g/mol. Its IUPAC name is 2-amino-8-methyl-3,7-dihydropteridin-4-one.
Molecular Properties
| Compound Name | 2-amino-8-methyl-3,7-dihydropteridin-4-one |
| PubChem CID | 135454624 |
| Molecular Formula | C7H9N5O |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2-amino-8-methyl-3,7-dihydropteridin-4-one |
| SMILES | CN1CC=Nc2c1nc(N)[nH]c2=O |
| InChI | InChI=1S/C7H9N5O/c1-12-3-2-9-4-5(12)10-7(8)11-6(4)13/h2H,3H2,1H3,(H3,8,10,11,13) |
| InChIKey | NJYUAWHEKRBMQB-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 87.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-8-methyl-3,7-dihydropteridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-8-methyl-3,7-dihydropteridin-4-one?
The IUPAC name of 2-amino-8-methyl-3,7-dihydropteridin-4-one (CID 135454624) is 2-amino-8-methyl-3,7-dihydropteridin-4-one.
What is the SMILES notation for 2-amino-8-methyl-3,7-dihydropteridin-4-one?
The canonical SMILES for 2-amino-8-methyl-3,7-dihydropteridin-4-one is CN1CC=Nc2c1nc(N)[nH]c2=O.
What is the InChIKey of 2-amino-8-methyl-3,7-dihydropteridin-4-one?
The InChIKey is NJYUAWHEKRBMQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O/c1-12-3-2-9-4-5(12)10-7(8)11-6(4)13/h2H,3H2,1H3,(H3,8,10,11,13).
What are the key properties of 2-amino-8-methyl-3,7-dihydropteridin-4-one?
2-amino-8-methyl-3,7-dihydropteridin-4-one has a molecular weight of 179.18 g/mol, XLogP of -0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyl-3,7-dihydropteridin-4-one is sourced from PubChem (CID 135454624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).