C9H11N3O4S — CID 135454763
(2S,5R)-2-(2-diazoacetyl)-3,3-dimethyl-4,4-dioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-7-one (PubChem CID 135454763) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is (2S,5R)-2-(2-diazoacetyl)-3,3-dimethyl-4,4-dioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-7-one.
| Compound Name | (2S,5R)-2-(2-diazoacetyl)-3,3-dimethyl-4,4-dioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-7-one |
|---|---|
| PubChem CID | 135454763 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (2S,5R)-2-(2-diazoacetyl)-3,3-dimethyl-4,4-dioxo-4λ6-thia-1-azabicyclo[3.2.0]heptan-7-one |
| SMILES | CC1(C)[C@H](C(=O)C=[N+]=[N-])N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C9H11N3O4S/c1-9(2)8(5(13)4-11-10)12-6(14)3-7(12)17(9,15)16/h4,7-8H,3H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | YQQDTOJVWIXAAM-SFYZADRCSA-N |
| XLogP | -1.01 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|