C18H12O7 — CID 135454817
2,5-dihydroxy-3-phenyl-6-(3,4,5-trihydroxyphenyl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 135454817) has the molecular formula C18H12O7 and a molecular weight of 340.29 g/mol. Its IUPAC name is 2,5-dihydroxy-3-phenyl-6-(3,4,5-trihydroxyphenyl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,5-dihydroxy-3-phenyl-6-(3,4,5-trihydroxyphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 135454817 |
| Molecular Formula | C18H12O7 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2,5-dihydroxy-3-phenyl-6-(3,4,5-trihydroxyphenyl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C(O)=C(c2cc(O)c(O)c(O)c2)C(=O)C(O)=C1c1ccccc1 |
| InChI | InChI=1S/C18H12O7/c19-10-6-9(7-11(20)14(10)21)13-17(24)15(22)12(16(23)18(13)25)8-4-2-1-3-5-8/h1-7,19-22,25H |
| InChIKey | OZTXUNBXAHGFHP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|