C36H41NO2 — CID 135455012
2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol (PubChem CID 135455012) has the molecular formula C36H41NO2 and a molecular weight of 519.73 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 135455012 |
| Molecular Formula | C36H41NO2 |
| Molecular Weight | 519.73 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(2S)-1-hydroxy-1,1,3-triphenylpropan-2-yl]iminomethyl]phenol |
| SMILES | CC(C)(C)c1cc(/C=N/[C@@H](Cc2ccccc2)C(O)(c2ccccc2)c2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H41NO2/c1-34(2,3)30-23-27(33(38)31(24-30)35(4,5)6)25-37-32(22-26-16-10-7-11-17-26)36(39,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-21,23-25,32,38-39H,22H2,1-6H3/b37-25+/t32-/m0/s1 |
| InChIKey | XNAGIYUBJYIIHP-LRQHUXSISA-N |
| XLogP | 7.95 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.73 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|