C15H15N5O4S — CID 135455116
2-[(2Z)-2-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135455116) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135455116 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 2-[(2Z)-2-[(E)-(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cn1c(=O)n(C)c2cc(/C=N/N=C3/NC(=O)C(CC(=O)O)S3)ccc21 |
| InChI | InChI=1S/C15H15N5O4S/c1-19-9-4-3-8(5-10(9)20(2)15(19)24)7-16-18-14-17-13(23)11(25-14)6-12(21)22/h3-5,7,11H,6H2,1-2H3,(H,21,22)(H,17,18,23)/b16-7+ |
| InChIKey | JDKJKELRAGWSJZ-FRKPEAEDSA-N |
| XLogP | 0.27 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|