About 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione
1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione (PubChem CID 135455255) has the molecular formula C6H6N4S2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione.
Molecular Properties
| Compound Name | 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione |
| PubChem CID | 135455255 |
| Molecular Formula | C6H6N4S2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione |
| SMILES | Cn1ncc2c(=S)[nH]c(=S)[nH]c21 |
| InChI | InChI=1S/C6H6N4S2/c1-10-4-3(2-7-10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12) |
| InChIKey | NJOOPHFHEJKSTP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione?
The IUPAC name of 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione (CID 135455255) is 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione.
What is the SMILES notation for 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione?
The canonical SMILES for 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione is Cn1ncc2c(=S)[nH]c(=S)[nH]c21.
What is the InChIKey of 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione?
The InChIKey is NJOOPHFHEJKSTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2/c1-10-4-3(2-7-10)5(11)9-6(12)8-4/h2H,1H3,(H2,8,9,11,12).
What are the key properties of 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione?
1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione has a molecular weight of 198.28 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7H-pyrazolo[5,4-d]pyrimidine-4,6-dithione is sourced from PubChem (CID 135455255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).