About (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide
(Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide (PubChem CID 135455494) has the molecular formula C18H26N2O4S
and a molecular weight of 366.48 g/mol. Its IUPAC name is (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide.
Molecular Properties
| Compound Name | (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide |
| PubChem CID | 135455494 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide |
| SMILES | CC(C)(C)/[N+]([O-])=C/C=C(/C=[N+](\[O-])C(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26N2O4S/c1-17(2,3)19(21)13-12-16(14-20(22)18(4,5)6)25(23,24)15-10-8-7-9-11-15/h7-14H,1-6H3/b16-12-,19-13-,20-14- |
| InChIKey | XSNKGXUCJRLXNT-KRNUDPOESA-N |
| XLogP | 3.10 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide?
The IUPAC name of (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide (CID 135455494) is (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide.
What is the SMILES notation for (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide?
The canonical SMILES for (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide is CC(C)(C)/[N+]([O-])=C/C=C(/C=[N+](\[O-])C(C)(C)C)S(=O)(=O)c1ccccc1.
What is the InChIKey of (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide?
The InChIKey is XSNKGXUCJRLXNT-KRNUDPOESA-N. The full InChI is InChI=1S/C18H26N2O4S/c1-17(2,3)19(21)13-12-16(14-20(22)18(4,5)6)25(23,24)15-10-8-7-9-11-15/h7-14H,1-6H3/b16-12-,19-13-,20-14-.
What are the key properties of (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide?
(Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide has a molecular weight of 366.48 g/mol, XLogP of 3.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(benzenesulfonyl)-N,N'-ditert-butylbut-2-ene-1,4-diimine oxide is sourced from PubChem (CID 135455494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).