C7H5ClN4O2 — CID 135455642
7-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine (PubChem CID 135455642) has the molecular formula C7H5ClN4O2 and a molecular weight of 212.60 g/mol. Its IUPAC name is 7-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine.
| Compound Name | 7-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
|---|---|
| PubChem CID | 135455642 |
| Molecular Formula | C7H5ClN4O2 |
| Molecular Weight | 212.60 g/mol |
| Exact Mass | 212.01 |
| IUPAC Name | 7-chloro-1,4-dioxido-1,2,4-benzotriazine-1,4-diium-3-amine |
| SMILES | Nc1n[n+]([O-])c2cc(Cl)ccc2[n+]1[O-] |
| InChI | InChI=1S/C7H5ClN4O2/c8-4-1-2-5-6(3-4)12(14)10-7(9)11(5)13/h1-3H,(H2,9,10) |
| InChIKey | VRAJXLCAHLGTJT-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.60 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|