C12H7BrN6 — CID 135455834
4-(2-bromophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 135455834) has the molecular formula C12H7BrN6 and a molecular weight of 315.13 g/mol. Its IUPAC name is 4-(2-bromophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 4-(2-bromophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 135455834 |
| Molecular Formula | C12H7BrN6 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-(2-bromophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Brc1ccccc1-c1nc2c3cn[nH]c3ncn2n1 |
| InChI | InChI=1S/C12H7BrN6/c13-9-4-2-1-3-7(9)11-16-12-8-5-15-17-10(8)14-6-19(12)18-11/h1-6H,(H,15,17) |
| InChIKey | VBALGRZMYLXSDT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |