C27H32N4O4 — CID 135455997
2-[(3,4-dimethoxyphenyl)methyl]-7-[(2R,3S)-2-hydroxy-6-phenylhexan-3-yl]-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one (PubChem CID 135455997) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-7-[(2R,3S)-2-hydroxy-6-phenylhexan-3-yl]-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-7-[(2R,3S)-2-hydroxy-6-phenylhexan-3-yl]-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 135455997 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-7-[(2R,3S)-2-hydroxy-6-phenylhexan-3-yl]-5-methyl-3H-imidazo[5,1-f][1,2,4]triazin-4-one |
| SMILES | COc1ccc(Cc2nn3c([C@H](CCCc4ccccc4)[C@@H](C)O)nc(C)c3c(=O)[nH]2)cc1OC |
| InChI | InChI=1S/C27H32N4O4/c1-17-25-27(33)29-24(16-20-13-14-22(34-3)23(15-20)35-4)30-31(25)26(28-17)21(18(2)32)12-8-11-19-9-6-5-7-10-19/h5-7,9-10,13-15,18,21,32H,8,11-12,16H2,1-4H3,(H,29,30,33)/t18-,21-/m1/s1 |
| InChIKey | MYTWFJKBZGMYCS-WIYYLYMNSA-N |
| XLogP | 3.82 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |