About 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 135456273) has the molecular formula C6H4N2O2S
and a molecular weight of 168.18 g/mol. Its IUPAC name is 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| PubChem CID | 135456273 |
| Molecular Formula | C6H4N2O2S |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | O=c1cc(O)nc2sccn12 |
| InChI | InChI=1S/C6H4N2O2S/c9-4-3-5(10)8-1-2-11-6(8)7-4/h1-3,9H |
| InChIKey | ZKTPOKCGJAGSAH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 135456273) is 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one is O=c1cc(O)nc2sccn12.
What is the InChIKey of 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is ZKTPOKCGJAGSAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2S/c9-4-3-5(10)8-1-2-11-6(8)7-4/h1-3,9H.
What are the key properties of 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 168.18 g/mol, XLogP of 0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 135456273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).